C29H33F2N7O2 — CID 155730055
N-[(2E,4E)-1-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl-methylamino]-4-pyridin-4-ylhepta-2,4,6-trien-2-yl]-N-(1-methylpiperidin-4-yl)formamide (PubChem CID 155730055) has the molecular formula C29H33F2N7O2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[(2E,4E)-1-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl-methylamino]-4-pyridin-4-ylhepta-2,4,6-trien-2-yl]-N-(1-methylpiperidin-4-yl)formamide.
| Compound Name | N-[(2E,4E)-1-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl-methylamino]-4-pyridin-4-ylhepta-2,4,6-trien-2-yl]-N-(1-methylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 155730055 |
| Molecular Formula | C29H33F2N7O2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | N-[(2E,4E)-1-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl-methylamino]-4-pyridin-4-ylhepta-2,4,6-trien-2-yl]-N-(1-methylpiperidin-4-yl)formamide |
| SMILES | C=C/C=C(\C=C(/CN(C)Cc1ccc(-c2nnc(C(F)F)o2)cn1)N(C=O)C1CCN(C)CC1)c1ccncc1 |
| InChI | InChI=1S/C29H33F2N7O2/c1-4-5-22(21-8-12-32-13-9-21)16-26(38(20-39)25-10-14-36(2)15-11-25)19-37(3)18-24-7-6-23(17-33-24)28-34-35-29(40-28)27(30)31/h4-9,12-13,16-17,20,25,27H,1,10-11,14-15,18-19H2,2-3H3/b22-5+,26-16+ |
| InChIKey | LURDEVVNBAMMDW-BSNVGPQBSA-N |
| XLogP | 4.60 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|