C12H23F2NO4 — CID 155731810
ethyl 3-[(1,1-difluoro-4-oxobutan-2-yl)amino]propanoate;methoxyethane (PubChem CID 155731810) has the molecular formula C12H23F2NO4 and a molecular weight of 283.31 g/mol. Its IUPAC name is ethyl 3-[(1,1-difluoro-4-oxobutan-2-yl)amino]propanoate;methoxyethane.
| Compound Name | ethyl 3-[(1,1-difluoro-4-oxobutan-2-yl)amino]propanoate;methoxyethane |
|---|---|
| PubChem CID | 155731810 |
| Molecular Formula | C12H23F2NO4 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethyl 3-[(1,1-difluoro-4-oxobutan-2-yl)amino]propanoate;methoxyethane |
| SMILES | CCOC.CCOC(=O)CCNC(CC=O)C(F)F |
| InChI | InChI=1S/C9H15F2NO3.C3H8O/c1-2-15-8(14)3-5-12-7(4-6-13)9(10)11;1-3-4-2/h6-7,9,12H,2-5H2,1H3;3H2,1-2H3 |
| InChIKey | DHVHDBXWHMBPCZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|