C15H20N6O2S — CID 155732609
2-(benzylamino)-N'-hydrazinyl-5-(methylsulfamoyl)benzenecarboximidamide (PubChem CID 155732609) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-(benzylamino)-N'-hydrazinyl-5-(methylsulfamoyl)benzenecarboximidamide.
| Compound Name | 2-(benzylamino)-N'-hydrazinyl-5-(methylsulfamoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 155732609 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(benzylamino)-N'-hydrazinyl-5-(methylsulfamoyl)benzenecarboximidamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2ccccc2)c(/C(N)=N/NN)c1 |
| InChI | InChI=1S/C15H20N6O2S/c1-18-24(22,23)12-7-8-14(13(9-12)15(16)20-21-17)19-10-11-5-3-2-4-6-11/h2-9,18-19,21H,10,17H2,1H3,(H2,16,20) |
| InChIKey | VOHZSTVSPMGWEU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|