C15H23F2NO2 — CID 155733613
2-(2,4-difluorophenyl)butanamide;1-methoxy-2-methylpropane (PubChem CID 155733613) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)butanamide;1-methoxy-2-methylpropane.
| Compound Name | 2-(2,4-difluorophenyl)butanamide;1-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 155733613 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)butanamide;1-methoxy-2-methylpropane |
| SMILES | CCC(C(N)=O)c1ccc(F)cc1F.COCC(C)C |
| InChI | InChI=1S/C10H11F2NO.C5H12O/c1-2-7(10(13)14)8-4-3-6(11)5-9(8)12;1-5(2)4-6-3/h3-5,7H,2H2,1H3,(H2,13,14);5H,4H2,1-3H3 |
| InChIKey | QEQYVUZXRCSFTJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |