C11H12F2N2O4 — CID 123475451
[1-carbamoyloxy-1-(2,4-difluorophenyl)propan-2-yl] carbamate (PubChem CID 123475451) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is [1-carbamoyloxy-1-(2,4-difluorophenyl)propan-2-yl] carbamate.
| Compound Name | [1-carbamoyloxy-1-(2,4-difluorophenyl)propan-2-yl] carbamate |
|---|---|
| PubChem CID | 123475451 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [1-carbamoyloxy-1-(2,4-difluorophenyl)propan-2-yl] carbamate |
| SMILES | CC(OC(N)=O)C(OC(N)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O4/c1-5(18-10(14)16)9(19-11(15)17)7-3-2-6(12)4-8(7)13/h2-5,9H,1H3,(H2,14,16)(H2,15,17) |
| InChIKey | WXPFFELONAYIMT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |