C22H31FN2S — CID 155735985
4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-6-methyl-1-[(E)-1-[(Z)-prop-1-enyl]sulfanylbut-1-enyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 155735985) has the molecular formula C22H31FN2S and a molecular weight of 374.57 g/mol. Its IUPAC name is 4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-6-methyl-1-[(E)-1-[(Z)-prop-1-enyl]sulfanylbut-1-enyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-6-methyl-1-[(E)-1-[(Z)-prop-1-enyl]sulfanylbut-1-enyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 155735985 |
| Molecular Formula | C22H31FN2S |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-6-methyl-1-[(E)-1-[(Z)-prop-1-enyl]sulfanylbut-1-enyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | C=C(/C=C\CC(C)F)C1=C2CC(C)CN2C(/C(=C\CC)S/C=C\C)=NC1 |
| InChI | InChI=1S/C22H31FN2S/c1-6-9-21(26-12-7-2)22-24-14-19(17(4)10-8-11-18(5)23)20-13-16(3)15-25(20)22/h7-10,12,16,18H,4,6,11,13-15H2,1-3,5H3/b10-8-,12-7-,21-9+ |
| InChIKey | NJNDHVMORPOTFN-GVRNCZBMSA-N |
| XLogP | 6.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|