C7H12FIO — CID 155736395
trans-(1R,2R)-1-fluoro-2-(1-iodoethoxy)cyclopentane (PubChem CID 155736395) has the molecular formula C7H12FIO and a molecular weight of 258.07 g/mol. Its IUPAC name is trans-(1R,2R)-1-fluoro-2-(1-iodoethoxy)cyclopentane.
| Compound Name | trans-(1R,2R)-1-fluoro-2-(1-iodoethoxy)cyclopentane |
|---|---|
| PubChem CID | 155736395 |
| Molecular Formula | C7H12FIO |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | trans-(1R,2R)-1-fluoro-2-(1-iodoethoxy)cyclopentane |
| SMILES | CC(I)O[C@@H]1CCC[C@H]1F |
| InChI | InChI=1S/C7H12FIO/c1-5(9)10-7-4-2-3-6(7)8/h5-7H,2-4H2,1H3/t5?,6-,7-/m1/s1 |
| InChIKey | GGKUFJNCFCPYNP-JXBXZBNISA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|