C9H10Cl3NO — CID 155736478
[(2E)-2-ethenylpenta-2,4-dienyl] 2,2,2-trichloroethanimidate (PubChem CID 155736478) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 155736478 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C(C=C)=C/C=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3NO/c1-3-5-7(4-2)6-14-8(13)9(10,11)12/h3-5,13H,1-2,6H2/b7-5+,13-8- |
| InChIKey | RHCBXEHOGYLAHE-DUHYVXLSSA-N |
| XLogP | 3.65 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|