C10H12Cl3NO — CID 142032928
[(3E)-3-ethenylhexa-3,5-dien-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 142032928) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is [(3E)-3-ethenylhexa-3,5-dien-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3E)-3-ethenylhexa-3,5-dien-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 142032928 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | [(3E)-3-ethenylhexa-3,5-dien-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC(C)/C(C=C)=C/C=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO/c1-4-6-8(5-2)7(3)15-9(14)10(11,12)13/h4-7,14H,1-2H2,3H3/b8-6+,14-9- |
| InChIKey | YUMAJHGDULIFDL-SUGUTGAESA-N |
| XLogP | 4.04 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|