C16H30N2O — CID 155739466
1-(cyclohexylmethyl)-4-methylpyrazole;3-methylbutan-1-ol (PubChem CID 155739466) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-methylpyrazole;3-methylbutan-1-ol.
| Compound Name | 1-(cyclohexylmethyl)-4-methylpyrazole;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 155739466 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-methylpyrazole;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.Cc1cnn(CC2CCCCC2)c1 |
| InChI | InChI=1S/C11H18N2.C5H12O/c1-10-7-12-13(8-10)9-11-5-3-2-4-6-11;1-5(2)3-4-6/h7-8,11H,2-6,9H2,1H3;5-6H,3-4H2,1-2H3 |
| InChIKey | GIGCVQWOZVFRMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |