C18H34N2O — CID 153390723
1-(cyclohexylmethyl)-4-propylpyrazole;3-methylbutan-1-ol (PubChem CID 153390723) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-propylpyrazole;3-methylbutan-1-ol.
| Compound Name | 1-(cyclohexylmethyl)-4-propylpyrazole;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 153390723 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-propylpyrazole;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CCCc1cnn(CC2CCCCC2)c1 |
| InChI | InChI=1S/C13H22N2.C5H12O/c1-2-6-13-9-14-15(11-13)10-12-7-4-3-5-8-12;1-5(2)3-4-6/h9,11-12H,2-8,10H2,1H3;5-6H,3-4H2,1-2H3 |
| InChIKey | SMTIPSOOEYNKLL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |