C13H27FN2O3 — CID 155739473
N-[3-[2-[2-(dimethylamino)ethoxy]ethoxy]-2-fluorobutyl]propanamide (PubChem CID 155739473) has the molecular formula C13H27FN2O3 and a molecular weight of 278.37 g/mol. Its IUPAC name is N-[3-[2-[2-(dimethylamino)ethoxy]ethoxy]-2-fluorobutyl]propanamide.
| Compound Name | N-[3-[2-[2-(dimethylamino)ethoxy]ethoxy]-2-fluorobutyl]propanamide |
|---|---|
| PubChem CID | 155739473 |
| Molecular Formula | C13H27FN2O3 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[3-[2-[2-(dimethylamino)ethoxy]ethoxy]-2-fluorobutyl]propanamide |
| SMILES | CCC(=O)NCC(F)C(C)OCCOCCN(C)C |
| InChI | InChI=1S/C13H27FN2O3/c1-5-13(17)15-10-12(14)11(2)19-9-8-18-7-6-16(3)4/h11-12H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | REHDEUZSNDFSJR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|