C24H43N3O2 — CID 155739576
2-[2-(4-methylpentoxy)ethoxy]-N-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]ethanamine (PubChem CID 155739576) has the molecular formula C24H43N3O2 and a molecular weight of 405.63 g/mol. Its IUPAC name is 2-[2-(4-methylpentoxy)ethoxy]-N-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]ethanamine.
| Compound Name | 2-[2-(4-methylpentoxy)ethoxy]-N-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 155739576 |
| Molecular Formula | C24H43N3O2 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 2-[2-(4-methylpentoxy)ethoxy]-N-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CC(C)CCCOCCOCCNCc1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H43N3O2/c1-21(2)6-5-16-28-18-19-29-17-11-25-20-23-7-9-24(10-8-23)27-14-12-26(13-15-27)22(3)4/h7-10,21-22,25H,5-6,11-20H2,1-4H3 |
| InChIKey | ZEOGCSXBKSUPKQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|