C23H36N4O — CID 155740614
8-[5-(cyclohexen-1-yl)pyrimidin-2-yl]-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane;2-methylpropanal (PubChem CID 155740614) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 8-[5-(cyclohexen-1-yl)pyrimidin-2-yl]-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane;2-methylpropanal.
| Compound Name | 8-[5-(cyclohexen-1-yl)pyrimidin-2-yl]-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane;2-methylpropanal |
|---|---|
| PubChem CID | 155740614 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 8-[5-(cyclohexen-1-yl)pyrimidin-2-yl]-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane;2-methylpropanal |
| SMILES | CC(C)C=O.CC(C)N1CC2CCC(C1)N2c1ncc(C2=CCCCC2)cn1 |
| InChI | InChI=1S/C19H28N4.C4H8O/c1-14(2)22-12-17-8-9-18(13-22)23(17)19-20-10-16(11-21-19)15-6-4-3-5-7-15;1-4(2)3-5/h6,10-11,14,17-18H,3-5,7-9,12-13H2,1-2H3;3-4H,1-2H3 |
| InChIKey | AAXCIHCKDNQGBC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|