C20H33N5O — CID 163400809
N-pentyl-2-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]acetamide (PubChem CID 163400809) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is N-pentyl-2-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]acetamide.
| Compound Name | N-pentyl-2-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 163400809 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-pentyl-2-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]acetamide |
| SMILES | CCCCCNC(=O)Cc1cnc(N2C3CCC2CN(C(C)C)C3)nc1 |
| InChI | InChI=1S/C20H33N5O/c1-4-5-6-9-21-19(26)10-16-11-22-20(23-12-16)25-17-7-8-18(25)14-24(13-17)15(2)3/h11-12,15,17-18H,4-10,13-14H2,1-3H3,(H,21,26) |
| InChIKey | SLGNYWRGESTACL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|