C25H42N6O2 — CID 167109842
2-methoxy-N-[6-[4-[2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]piperidin-1-yl]hexyl]acetamide (PubChem CID 167109842) has the molecular formula C25H42N6O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-methoxy-N-[6-[4-[2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]piperidin-1-yl]hexyl]acetamide.
| Compound Name | 2-methoxy-N-[6-[4-[2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]piperidin-1-yl]hexyl]acetamide |
|---|---|
| PubChem CID | 167109842 |
| Molecular Formula | C25H42N6O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2-methoxy-N-[6-[4-[2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]piperidin-1-yl]hexyl]acetamide |
| SMILES | COCC(=O)NCCCCCCN1CCC(c2cnc(N3C4CCC3CN(C)C4)nc2)CC1 |
| InChI | InChI=1S/C25H42N6O2/c1-29-17-22-7-8-23(18-29)31(22)25-27-15-21(16-28-25)20-9-13-30(14-10-20)12-6-4-3-5-11-26-24(32)19-33-2/h15-16,20,22-23H,3-14,17-19H2,1-2H3,(H,26,32) |
| InChIKey | LZGVCARKPAEIQJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|