About 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane
2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane (PubChem CID 155743249) has the molecular formula C22H42O
and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane.
Molecular Properties
| Compound Name | 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane |
| PubChem CID | 155743249 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane |
| SMILES | C=CC1CCC(CC=O)C1C/C=C\C.CC.CCCCCCC |
| InChI | InChI=1S/C13H20O.C7H16.C2H6/c1-3-5-6-13-11(4-2)7-8-12(13)9-10-14;1-3-5-7-6-4-2;1-2/h3-5,10-13H,2,6-9H2,1H3;3-7H2,1-2H3;1-2H3/b5-3-;; |
| InChIKey | LSZFEGVNMXZIMI-ORIPCLHRSA-N |
| XLogP | 7.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane?
The IUPAC name of 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane (CID 155743249) is 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane.
What is the SMILES notation for 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane?
The canonical SMILES for 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane is C=CC1CCC(CC=O)C1C/C=C\C.CC.CCCCCCC.
What is the InChIKey of 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane?
The InChIKey is LSZFEGVNMXZIMI-ORIPCLHRSA-N. The full InChI is InChI=1S/C13H20O.C7H16.C2H6/c1-3-5-6-13-11(4-2)7-8-12(13)9-10-14;1-3-5-7-6-4-2;1-2/h3-5,10-13H,2,6-9H2,1H3;3-7H2,1-2H3;1-2H3/b5-3-;;.
What are the key properties of 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane?
2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane has a molecular weight of 322.58 g/mol, XLogP of 7.37, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(Z)-but-2-enyl]-3-ethenylcyclopentyl]acetaldehyde;ethane;heptane is sourced from PubChem (CID 155743249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).