C22H20N3O2+ — CID 155747565
methylidene-[4-methyl-3-(2-pyridin-3-ylethynyl)benzoyl]-(4-propan-2-yl-1,3-oxazol-2-yl)azanium (PubChem CID 155747565) has the molecular formula C22H20N3O2+ and a molecular weight of 358.42 g/mol. Its IUPAC name is methylidene-[4-methyl-3-(2-pyridin-3-ylethynyl)benzoyl]-(4-propan-2-yl-1,3-oxazol-2-yl)azanium.
| Compound Name | methylidene-[4-methyl-3-(2-pyridin-3-ylethynyl)benzoyl]-(4-propan-2-yl-1,3-oxazol-2-yl)azanium |
|---|---|
| PubChem CID | 155747565 |
| Molecular Formula | C22H20N3O2+ |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methylidene-[4-methyl-3-(2-pyridin-3-ylethynyl)benzoyl]-(4-propan-2-yl-1,3-oxazol-2-yl)azanium |
| SMILES | C=[N+](C(=O)c1ccc(C)c(C#Cc2cccnc2)c1)c1nc(C(C)C)co1 |
| InChI | InChI=1S/C22H20N3O2/c1-15(2)20-14-27-22(24-20)25(4)21(26)19-9-7-16(3)18(12-19)10-8-17-6-5-11-23-13-17/h5-7,9,11-15H,4H2,1-3H3/q+1 |
| InChIKey | LYXKFNSFPXBYIP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|