C18H22ClNO2 — CID 155747880
1-[3-(3-amino-2-chlorophenoxy)-2,6-dimethylphenyl]ethanone;ethane (PubChem CID 155747880) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 1-[3-(3-amino-2-chlorophenoxy)-2,6-dimethylphenyl]ethanone;ethane.
| Compound Name | 1-[3-(3-amino-2-chlorophenoxy)-2,6-dimethylphenyl]ethanone;ethane |
|---|---|
| PubChem CID | 155747880 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[3-(3-amino-2-chlorophenoxy)-2,6-dimethylphenyl]ethanone;ethane |
| SMILES | CC.CC(=O)c1c(C)ccc(Oc2cccc(N)c2Cl)c1C |
| InChI | InChI=1S/C16H16ClNO2.C2H6/c1-9-7-8-13(10(2)15(9)11(3)19)20-14-6-4-5-12(18)16(14)17;1-2/h4-8H,18H2,1-3H3;1-2H3 |
| InChIKey | WCIFIDVKMLFVEV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|