About 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone
1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone (PubChem CID 155443762) has the molecular formula C16H14ClF2NO2
and a molecular weight of 325.74 g/mol. Its IUPAC name is 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone |
| PubChem CID | 155443762 |
| Molecular Formula | C16H14ClF2NO2 |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone |
| SMILES | CC(=O)c1c(C)ccc(Oc2c(F)c(F)cc(N)c2Cl)c1C |
| InChI | InChI=1S/C16H14ClF2NO2/c1-7-4-5-12(8(2)13(7)9(3)21)22-16-14(17)11(20)6-10(18)15(16)19/h4-6H,20H2,1-3H3 |
| InChIKey | DJQMBEFLESHHGJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone?
The IUPAC name of 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone (CID 155443762) is 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone.
What is the SMILES notation for 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone?
The canonical SMILES for 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone is CC(=O)c1c(C)ccc(Oc2c(F)c(F)cc(N)c2Cl)c1C.
What is the InChIKey of 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone?
The InChIKey is DJQMBEFLESHHGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClF2NO2/c1-7-4-5-12(8(2)13(7)9(3)21)22-16-14(17)11(20)6-10(18)15(16)19/h4-6H,20H2,1-3H3.
What are the key properties of 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone?
1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone has a molecular weight of 325.74 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3-amino-2-chloro-5,6-difluorophenoxy)-2,6-dimethylphenyl]ethanone is sourced from PubChem (CID 155443762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).