C13H22FN — CID 155749589
(3E,5E)-6-fluoro-N,N-dipropylhepta-1,3,5-trien-4-amine (PubChem CID 155749589) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-N,N-dipropylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-6-fluoro-N,N-dipropylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 155749589 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3E,5E)-6-fluoro-N,N-dipropylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C(/C)F)N(CCC)CCC |
| InChI | InChI=1S/C13H22FN/c1-5-8-13(11-12(4)14)15(9-6-2)10-7-3/h5,8,11H,1,6-7,9-10H2,2-4H3/b12-11+,13-8+ |
| InChIKey | ZZGLSVDASNSIQT-FYXALXGLSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|