C27H29N5O — CID 155749853
N-[3-[1-[2-(1-anilinobut-3-en-2-ylideneamino)ethenylamino]ethyl]phenyl]-5-methylpyridine-3-carboxamide (PubChem CID 155749853) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[3-[1-[2-(1-anilinobut-3-en-2-ylideneamino)ethenylamino]ethyl]phenyl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[3-[1-[2-(1-anilinobut-3-en-2-ylideneamino)ethenylamino]ethyl]phenyl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155749853 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[3-[1-[2-(1-anilinobut-3-en-2-ylideneamino)ethenylamino]ethyl]phenyl]-5-methylpyridine-3-carboxamide |
| SMILES | C=C/C(CNc1ccccc1)=N\C=CNC(C)c1cccc(NC(=O)c2cncc(C)c2)c1 |
| InChI | InChI=1S/C27H29N5O/c1-4-24(19-31-25-10-6-5-7-11-25)30-14-13-29-21(3)22-9-8-12-26(16-22)32-27(33)23-15-20(2)17-28-18-23/h4-18,21,29,31H,1,19H2,2-3H3,(H,32,33)/b14-13?,30-24+ |
| InChIKey | QDXGPNOYBZVOBI-JFJIRQPKSA-N |
| XLogP | 5.50 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|