C24H26N4O4 — CID 155749997
1-[3-[(4-ethoxycarbonyloxybenzoyl)amino]phenyl]ethyl-[2-[(1-methylazet-1-ium-3-yl)amino]ethenyl]azanide (PubChem CID 155749997) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-[3-[(4-ethoxycarbonyloxybenzoyl)amino]phenyl]ethyl-[2-[(1-methylazet-1-ium-3-yl)amino]ethenyl]azanide.
| Compound Name | 1-[3-[(4-ethoxycarbonyloxybenzoyl)amino]phenyl]ethyl-[2-[(1-methylazet-1-ium-3-yl)amino]ethenyl]azanide |
|---|---|
| PubChem CID | 155749997 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[3-[(4-ethoxycarbonyloxybenzoyl)amino]phenyl]ethyl-[2-[(1-methylazet-1-ium-3-yl)amino]ethenyl]azanide |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(C(C)[N-]C=CNC3=C[N+](C)=C3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-4-31-24(30)32-22-10-8-18(9-11-22)23(29)27-20-7-5-6-19(14-20)17(2)25-12-13-26-21-15-28(3)16-21/h5-17,26H,4H2,1-3H3,(H,27,29) |
| InChIKey | UQZMPJNTMFUDIA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|