About N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane
N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane (PubChem CID 155751635) has the molecular formula C14H31NO3
and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane.
Molecular Properties
| Compound Name | N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane |
| PubChem CID | 155751635 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane |
| SMILES | CC(C)C.CCCCOCCOCCN(C)C=O |
| InChI | InChI=1S/C10H21NO3.C4H10/c1-3-4-6-13-8-9-14-7-5-11(2)10-12;1-4(2)3/h10H,3-9H2,1-2H3;4H,1-3H3 |
| InChIKey | HRZHMVISUZMQFT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane?
The IUPAC name of N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane (CID 155751635) is N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane.
What is the SMILES notation for N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane?
The canonical SMILES for N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane is CC(C)C.CCCCOCCOCCN(C)C=O.
What is the InChIKey of N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane?
The InChIKey is HRZHMVISUZMQFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3.C4H10/c1-3-4-6-13-8-9-14-7-5-11(2)10-12;1-4(2)3/h10H,3-9H2,1-2H3;4H,1-3H3.
What are the key properties of N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane?
N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane has a molecular weight of 261.41 g/mol, XLogP of 2.57, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-butoxyethoxy)ethyl]-N-methylformamide;2-methylpropane is sourced from PubChem (CID 155751635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).