C16H38N2O — CID 155751068
N'-(2-butoxyethyl)-N'-ethyl-N,N-dimethylethane-1,2-diamine;2-methylpropane (PubChem CID 155751068) has the molecular formula C16H38N2O and a molecular weight of 274.49 g/mol. Its IUPAC name is N'-(2-butoxyethyl)-N'-ethyl-N,N-dimethylethane-1,2-diamine;2-methylpropane.
| Compound Name | N'-(2-butoxyethyl)-N'-ethyl-N,N-dimethylethane-1,2-diamine;2-methylpropane |
|---|---|
| PubChem CID | 155751068 |
| Molecular Formula | C16H38N2O |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.30 |
| IUPAC Name | N'-(2-butoxyethyl)-N'-ethyl-N,N-dimethylethane-1,2-diamine;2-methylpropane |
| SMILES | CC(C)C.CCCCOCCN(CC)CCN(C)C |
| InChI | InChI=1S/C12H28N2O.C4H10/c1-5-7-11-15-12-10-14(6-2)9-8-13(3)4;1-4(2)3/h5-12H2,1-4H3;4H,1-3H3 |
| InChIKey | MMQGJUCECFLARM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|