C16H40N2OSn — CID 174751010
dibutylstannane;2-[2-(dimethylamino)ethoxy]-N,N-dimethylethanamine (PubChem CID 174751010) has the molecular formula C16H40N2OSn and a molecular weight of 395.22 g/mol. Its IUPAC name is dibutylstannane;2-[2-(dimethylamino)ethoxy]-N,N-dimethylethanamine.
| Compound Name | dibutylstannane;2-[2-(dimethylamino)ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 174751010 |
| Molecular Formula | C16H40N2OSn |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | dibutylstannane;2-[2-(dimethylamino)ethoxy]-N,N-dimethylethanamine |
| SMILES | CCCC[SnH2]CCCC.CN(C)CCOCCN(C)C |
| InChI | InChI=1S/C8H20N2O.2C4H9.Sn.2H/c1-9(2)5-7-11-8-6-10(3)4;2*1-3-4-2;;;/h5-8H2,1-4H3;2*1,3-4H2,2H3;;; |
| InChIKey | ZQMLSCBMHTWTJV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|