C22H25F5N4O3 — CID 155751658
2-amino-N-cyclohexyl-3-fluoro-4-methoxy-5-[[6-(trifluoromethyl)pyridine-2-carbonyl]amino]benzenecarboximidoyl fluoride;methanol (PubChem CID 155751658) has the molecular formula C22H25F5N4O3 and a molecular weight of 488.46 g/mol. Its IUPAC name is 2-amino-N-cyclohexyl-3-fluoro-4-methoxy-5-[[6-(trifluoromethyl)pyridine-2-carbonyl]amino]benzenecarboximidoyl fluoride;methanol.
| Compound Name | 2-amino-N-cyclohexyl-3-fluoro-4-methoxy-5-[[6-(trifluoromethyl)pyridine-2-carbonyl]amino]benzenecarboximidoyl fluoride;methanol |
|---|---|
| PubChem CID | 155751658 |
| Molecular Formula | C22H25F5N4O3 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-amino-N-cyclohexyl-3-fluoro-4-methoxy-5-[[6-(trifluoromethyl)pyridine-2-carbonyl]amino]benzenecarboximidoyl fluoride;methanol |
| SMILES | CO.COc1c(NC(=O)c2cccc(C(F)(F)F)n2)cc(/C(F)=N/C2CCCCC2)c(N)c1F |
| InChI | InChI=1S/C21H21F5N4O2.CH4O/c1-32-18-14(30-20(31)13-8-5-9-15(29-13)21(24,25)26)10-12(17(27)16(18)22)19(23)28-11-6-3-2-4-7-11;1-2/h5,8-11H,2-4,6-7,27H2,1H3,(H,30,31);2H,1H3/b28-19-; |
| InChIKey | PEJXYHPNRJRGLA-IKKIYUABSA-N |
| XLogP | 4.74 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|