C31H57N3O — CID 155752544
2-(12a-methyl-8-propyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl)-N-[(Z)-butan-2-ylideneamino]-N-(methylideneamino)propan-1-amine;methanol (PubChem CID 155752544) has the molecular formula C31H57N3O and a molecular weight of 487.82 g/mol. Its IUPAC name is 2-(12a-methyl-8-propyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl)-N-[(Z)-butan-2-ylideneamino]-N-(methylideneamino)propan-1-amine;methanol.
| Compound Name | 2-(12a-methyl-8-propyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl)-N-[(Z)-butan-2-ylideneamino]-N-(methylideneamino)propan-1-amine;methanol |
|---|---|
| PubChem CID | 155752544 |
| Molecular Formula | C31H57N3O |
| Molecular Weight | 487.82 g/mol |
| Exact Mass | 487.45 |
| IUPAC Name | 2-(12a-methyl-8-propyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl)-N-[(Z)-butan-2-ylideneamino]-N-(methylideneamino)propan-1-amine;methanol |
| SMILES | C=NN(CC(C)C1CCCC2C3CCC4CC(CCC)CCC4C3CCC12C)/N=C(/C)CC.CO |
| InChI | InChI=1S/C30H53N3.CH4O/c1-7-10-23-13-15-25-24(19-23)14-16-27-26(25)17-18-30(5)28(11-9-12-29(27)30)21(3)20-33(31-6)32-22(4)8-2;1-2/h21,23-29H,6-20H2,1-5H3;2H,1H3/b32-22-; |
| InChIKey | CMBIDWUPCGZYQC-PXPBGKKLSA-N |
| XLogP | 8.01 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|