C30H45N3O — CID 155752668
1-[(2S)-2-[(2S,5S,11R,15R,16S)-5-[(E)-2-hydroxyethenyl]-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]propyl]pyrazole-4-carbonitrile (PubChem CID 155752668) has the molecular formula C30H45N3O and a molecular weight of 463.71 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S,5S,11R,15R,16S)-5-[(E)-2-hydroxyethenyl]-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]propyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[(2S)-2-[(2S,5S,11R,15R,16S)-5-[(E)-2-hydroxyethenyl]-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]propyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 155752668 |
| Molecular Formula | C30H45N3O |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.36 |
| IUPAC Name | 1-[(2S)-2-[(2S,5S,11R,15R,16S)-5-[(E)-2-hydroxyethenyl]-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadecanyl]propyl]pyrazole-4-carbonitrile |
| SMILES | C[C@H](Cn1cc(C#N)cn1)[C@H]1CCC2[C@@H]3CCC4CC[C@](C)(/C=C/O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H45N3O/c1-21(19-33-20-22(17-31)18-32-33)25-7-8-26-24-6-5-23-9-11-28(2,15-16-34)13-14-29(23,3)27(24)10-12-30(25,26)4/h15-16,18,20-21,23-27,34H,5-14,19H2,1-4H3/b16-15+/t21-,23?,24+,25-,26?,27?,28+,29+,30-/m1/s1 |
| InChIKey | YUFJXFJTXMMXSF-MWBVESCQSA-N |
| XLogP | 7.52 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|