C28H41N3O — CID 155438700
1-[2-[(1S,2R,5S,11S,12S,15R,16S)-5-hydroxy-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]propyl]pyrazole-4-carbonitrile (PubChem CID 155438700) has the molecular formula C28H41N3O and a molecular weight of 435.66 g/mol. Its IUPAC name is 1-[2-[(1S,2R,5S,11S,12S,15R,16S)-5-hydroxy-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]propyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[2-[(1S,2R,5S,11S,12S,15R,16S)-5-hydroxy-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]propyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 155438700 |
| Molecular Formula | C28H41N3O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 1-[2-[(1S,2R,5S,11S,12S,15R,16S)-5-hydroxy-2,5,16-trimethyl-15-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl]propyl]pyrazole-4-carbonitrile |
| SMILES | CC(Cn1cc(C#N)cn1)[C@H]1CC[C@H]2[C@@H]3CC=C4CC[C@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H41N3O/c1-19(17-31-18-20(15-29)16-30-31)23-7-8-24-22-6-5-21-9-11-26(2,32)13-14-27(21,3)25(22)10-12-28(23,24)4/h5,16,18-19,22-25,32H,6-14,17H2,1-4H3/t19?,22-,23+,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | SESMRIHTXDZXFT-LULOSRTOSA-N |
| XLogP | 6.11 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|