C13H14FNO6 — CID 155753121
methyl 2-[2-[(5-fluoro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate (PubChem CID 155753121) has the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. Its IUPAC name is methyl 2-[2-[(5-fluoro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate.
| Compound Name | methyl 2-[2-[(5-fluoro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate |
|---|---|
| PubChem CID | 155753121 |
| Molecular Formula | C13H14FNO6 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 2-[2-[(5-fluoro-2-nitrophenyl)methyl]-1,3-dioxolan-2-yl]acetate |
| SMILES | COC(=O)CC1(Cc2cc(F)ccc2[N+](=O)[O-])OCCO1 |
| InChI | InChI=1S/C13H14FNO6/c1-19-12(16)8-13(20-4-5-21-13)7-9-6-10(14)2-3-11(9)15(17)18/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | ISLIOIAPAYDAFF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|