C26H32ClN3O4 — CID 155753287
2-(4-aminocyclohexyl)-9-chloro-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 155753287) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is 2-(4-aminocyclohexyl)-9-chloro-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | 2-(4-aminocyclohexyl)-9-chloro-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 155753287 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-(4-aminocyclohexyl)-9-chloro-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | Cc1cc(C)c(CN2CCc3c(Cl)c4c(c(C)c3C2=O)OC(C)(C2CCC(N)CC2)O4)c(=O)[nH]1 |
| InChI | InChI=1S/C26H32ClN3O4/c1-13-11-14(2)29-24(31)19(13)12-30-10-9-18-20(25(30)32)15(3)22-23(21(18)27)34-26(4,33-22)16-5-7-17(28)8-6-16/h11,16-17H,5-10,12,28H2,1-4H3,(H,29,31) |
| InChIKey | XMNTZNVLNXZUKW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |