C27H33ClN2O4 — CID 165012879
2-(4-aminocyclohexyl)-9-chloro-6-[(2,4-dimethyl-6-oxocyclohexa-1,3-dien-1-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 165012879) has the molecular formula C27H33ClN2O4 and a molecular weight of 485.02 g/mol. Its IUPAC name is 2-(4-aminocyclohexyl)-9-chloro-6-[(2,4-dimethyl-6-oxocyclohexa-1,3-dien-1-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | 2-(4-aminocyclohexyl)-9-chloro-6-[(2,4-dimethyl-6-oxocyclohexa-1,3-dien-1-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 165012879 |
| Molecular Formula | C27H33ClN2O4 |
| Molecular Weight | 485.02 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-(4-aminocyclohexyl)-9-chloro-6-[(2,4-dimethyl-6-oxocyclohexa-1,3-dien-1-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | CC1=CC(C)=C(CN2CCc3c(Cl)c4c(c(C)c3C2=O)OC(C)(C2CCC(N)CC2)O4)C(=O)C1 |
| InChI | InChI=1S/C27H33ClN2O4/c1-14-11-15(2)20(21(31)12-14)13-30-10-9-19-22(26(30)32)16(3)24-25(23(19)28)34-27(4,33-24)17-5-7-18(29)8-6-17/h11,17-18H,5-10,12-13,29H2,1-4H3 |
| InChIKey | JYVDZPZZRYHRHK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.02 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |