C14H15BrN4O3 — CID 155754646
ethyl 3-bromo-1-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]pyrazole-4-carboxylate (PubChem CID 155754646) has the molecular formula C14H15BrN4O3 and a molecular weight of 367.20 g/mol. Its IUPAC name is ethyl 3-bromo-1-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 3-bromo-1-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 155754646 |
| Molecular Formula | C14H15BrN4O3 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | ethyl 3-bromo-1-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc(/C(N)=N/O)cc2)nc1Br |
| InChI | InChI=1S/C14H15BrN4O3/c1-2-22-14(20)11-8-19(17-12(11)15)7-9-3-5-10(6-4-9)13(16)18-21/h3-6,8,21H,2,7H2,1H3,(H2,16,18) |
| InChIKey | FKCMOXWRHJKZIT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|