C11H11ClN4O — CID 54909727
4-[(4-chloropyrazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 54909727) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is 4-[(4-chloropyrazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(4-chloropyrazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 54909727 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-[(4-chloropyrazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(Cn2cc(Cl)cn2)cc1 |
| InChI | InChI=1S/C11H11ClN4O/c12-10-5-14-16(7-10)6-8-1-3-9(4-2-8)11(13)15-17/h1-5,7,17H,6H2,(H2,13,15) |
| InChIKey | YCYUVFDJVVPRKE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|