C28H48N4O11 — CID 155755217
[(3R)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethyl-2H-benzimidazol-5-yl)methanone (PubChem CID 155755217) has the molecular formula C28H48N4O11 and a molecular weight of 616.71 g/mol. Its IUPAC name is [(3R)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethyl-2H-benzimidazol-5-yl)methanone.
| Compound Name | [(3R)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethyl-2H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 155755217 |
| Molecular Formula | C28H48N4O11 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | [(3R)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethyl-2H-benzimidazol-5-yl)methanone |
| SMILES | CCN1CN(CC)c2cc(C(=O)N3CC[C@@H](N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C3)ccc21 |
| InChI | InChI=1S/C28H48N4O11/c1-3-29-15-30(4-2)19-9-16(5-6-18(19)29)28(43)31-8-7-17(10-31)32(11-20(35)24(39)26(41)22(37)13-33)12-21(36)25(40)27(42)23(38)14-34/h5-6,9,17,20-27,33-42H,3-4,7-8,10-15H2,1-2H3/t17-,20+,21+,22-,23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | PHBMFWDOKARJQS-SPABGWSPSA-N |
| XLogP | -4.30 |
| TPSA | 232.33 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |