C30H47F3N4O13 — CID 175734178
[(3S)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;2,2,2-trifluoroacetate (PubChem CID 175734178) has the molecular formula C30H47F3N4O13 and a molecular weight of 728.71 g/mol. Its IUPAC name is [(3S)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;2,2,2-trifluoroacetate.
| Compound Name | [(3S)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175734178 |
| Molecular Formula | C30H47F3N4O13 |
| Molecular Weight | 728.71 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | [(3S)-3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pyrrolidin-1-yl]-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;2,2,2-trifluoroacetate |
| SMILES | CCn1c[n+](CC)c2ccc(C(=O)N3CC[C@H](N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C3)cc21.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H47N4O11.C2HF3O2/c1-3-29-15-30(4-2)19-9-16(5-6-18(19)29)28(43)31-8-7-17(10-31)32(11-20(35)24(39)26(41)22(37)13-33)12-21(36)25(40)27(42)23(38)14-34;3-2(4,5)1(6)7/h5-6,9,15,17,20-27,33-42H,3-4,7-8,10-14H2,1-2H3;(H,6,7)/q+1;/p-1/t17-,20-,21-,22+,23+,24+,25+,26+,27+;/m0./s1 |
| InChIKey | WVJGXILQILNBAO-WTDSLVIPSA-M |
| XLogP | -5.34 |
| TPSA | 274.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.71 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|