C17H26ClIN4O — CID 142755344
(4-aminopiperidin-1-yl)-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;iodide;hydrochloride (PubChem CID 142755344) has the molecular formula C17H26ClIN4O and a molecular weight of 464.78 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;iodide;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;iodide;hydrochloride |
|---|---|
| PubChem CID | 142755344 |
| Molecular Formula | C17H26ClIN4O |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(1,3-diethylbenzimidazol-1-ium-5-yl)methanone;iodide;hydrochloride |
| SMILES | CCn1c[n+](CC)c2ccc(C(=O)N3CCC(N)CC3)cc21.Cl.[I-] |
| InChI | InChI=1S/C17H25N4O.ClH.HI/c1-3-19-12-20(4-2)16-11-13(5-6-15(16)19)17(22)21-9-7-14(18)8-10-21;;/h5-6,11-12,14H,3-4,7-10,18H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | NEOCIUFQJCOVSC-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 55.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|