C22H27F3N8O4 — CID 155757292
[3-[(3S)-3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]piperidin-1-yl]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate (PubChem CID 155757292) has the molecular formula C22H27F3N8O4 and a molecular weight of 524.50 g/mol. Its IUPAC name is [3-[(3S)-3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]piperidin-1-yl]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[(3S)-3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]piperidin-1-yl]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155757292 |
| Molecular Formula | C22H27F3N8O4 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [3-[(3S)-3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]piperidin-1-yl]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C(OC(=O)C(F)(F)F)C(=O)N1CCC[C@H](Nc2nc(Nc3cnn(C)c3)ncc2N2CCOCC2)C1 |
| InChI | InChI=1S/C22H27F3N8O4/c1-14(37-20(35)22(23,24)25)19(34)33-5-3-4-15(13-33)28-18-17(32-6-8-36-9-7-32)11-26-21(30-18)29-16-10-27-31(2)12-16/h10-12,15H,1,3-9,13H2,2H3,(H2,26,28,29,30)/t15-/m0/s1 |
| InChIKey | XIUNRIOVPSKSHJ-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|