C24H18F2N2O2S — CID 155760446
7-[2-(2,4-difluorophenoxy)-5-(2-isocyanopropan-2-yl)phenyl]-5-methylthieno[3,2-c]pyridin-4-one (PubChem CID 155760446) has the molecular formula C24H18F2N2O2S and a molecular weight of 436.48 g/mol. Its IUPAC name is 7-[2-(2,4-difluorophenoxy)-5-(2-isocyanopropan-2-yl)phenyl]-5-methylthieno[3,2-c]pyridin-4-one.
| Compound Name | 7-[2-(2,4-difluorophenoxy)-5-(2-isocyanopropan-2-yl)phenyl]-5-methylthieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155760446 |
| Molecular Formula | C24H18F2N2O2S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 7-[2-(2,4-difluorophenoxy)-5-(2-isocyanopropan-2-yl)phenyl]-5-methylthieno[3,2-c]pyridin-4-one |
| SMILES | [C-]#[N+]C(C)(C)c1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3ccsc23)c1 |
| InChI | InChI=1S/C24H18F2N2O2S/c1-24(2,27-3)14-5-7-20(30-21-8-6-15(25)12-19(21)26)17(11-14)18-13-28(4)23(29)16-9-10-31-22(16)18/h5-13H,1-2,4H3 |
| InChIKey | AHSDRBIJSWQMCU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 35.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|