C21H17F2N3O2S2 — CID 155458390
7-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)-3-pyridinyl]-5-methylthieno[3,2-c]pyridin-4-one (PubChem CID 155458390) has the molecular formula C21H17F2N3O2S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 7-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)-3-pyridinyl]-5-methylthieno[3,2-c]pyridin-4-one.
| Compound Name | 7-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)-3-pyridinyl]-5-methylthieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155458390 |
| Molecular Formula | C21H17F2N3O2S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 7-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)-3-pyridinyl]-5-methylthieno[3,2-c]pyridin-4-one |
| SMILES | CCSNc1cnc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3ccsc23)c1 |
| InChI | InChI=1S/C21H17F2N3O2S2/c1-3-30-25-13-9-15(16-11-26(2)21(27)14-6-7-29-19(14)16)20(24-10-13)28-18-5-4-12(22)8-17(18)23/h4-11,25H,3H2,1-2H3 |
| InChIKey | LWUSLAIEPHIYFX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|