C27H30F2N2O2S — CID 134512231
5-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-1,3-dimethyl-4-[(Z)-3-methylpent-1-enyl]pyridin-2-one (PubChem CID 134512231) has the molecular formula C27H30F2N2O2S and a molecular weight of 484.61 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-1,3-dimethyl-4-[(Z)-3-methylpent-1-enyl]pyridin-2-one.
| Compound Name | 5-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-1,3-dimethyl-4-[(Z)-3-methylpent-1-enyl]pyridin-2-one |
|---|---|
| PubChem CID | 134512231 |
| Molecular Formula | C27H30F2N2O2S |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 5-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-1,3-dimethyl-4-[(Z)-3-methylpent-1-enyl]pyridin-2-one |
| SMILES | CCSNc1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c(C)c2/C=C\C(C)CC)c1 |
| InChI | InChI=1S/C27H30F2N2O2S/c1-6-17(3)8-11-21-18(4)27(32)31(5)16-23(21)22-15-20(30-34-7-2)10-13-25(22)33-26-12-9-19(28)14-24(26)29/h8-17,30H,6-7H2,1-5H3/b11-8- |
| InChIKey | TWGKVMDLCJGOOE-FLIBITNWSA-N |
| XLogP | 7.57 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|