C15H15F2NOS — CID 134516597
4-(2,4-difluorophenoxy)-N-ethylsulfanyl-3-methylaniline (PubChem CID 134516597) has the molecular formula C15H15F2NOS and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-N-ethylsulfanyl-3-methylaniline.
| Compound Name | 4-(2,4-difluorophenoxy)-N-ethylsulfanyl-3-methylaniline |
|---|---|
| PubChem CID | 134516597 |
| Molecular Formula | C15H15F2NOS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-N-ethylsulfanyl-3-methylaniline |
| SMILES | CCSNc1ccc(Oc2ccc(F)cc2F)c(C)c1 |
| InChI | InChI=1S/C15H15F2NOS/c1-3-20-18-12-5-7-14(10(2)8-12)19-15-6-4-11(16)9-13(15)17/h4-9,18H,3H2,1-2H3 |
| InChIKey | CMGFUFZUWVYLGN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|