C22H17F5N3O2S+ — CID 135278586
4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-N-(2,2,2-trifluoroethylsulfanyl)aniline (PubChem CID 135278586) has the molecular formula C22H17F5N3O2S+ and a molecular weight of 482.45 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-N-(2,2,2-trifluoroethylsulfanyl)aniline.
| Compound Name | 4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-N-(2,2,2-trifluoroethylsulfanyl)aniline |
|---|---|
| PubChem CID | 135278586 |
| Molecular Formula | C22H17F5N3O2S+ |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-3-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-N-(2,2,2-trifluoroethylsulfanyl)aniline |
| SMILES | Cc1cc(-c2cc(NSCC(F)(F)F)ccc2Oc2ccc(F)cc2F)c2cc[nH]c2[n+]1O |
| InChI | InChI=1S/C22H16F5N3O2S/c1-12-8-16(15-6-7-28-21(15)30(12)31)17-10-14(29-33-11-22(25,26)27)3-5-19(17)32-20-4-2-13(23)9-18(20)24/h2-10,29,31H,11H2,1H3/p+1 |
| InChIKey | CALRMBAFGYKPMG-UHFFFAOYSA-O |
| XLogP | 6.36 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|