C23H23N2O3S+ — CID 135278633
[4-[4-ethylsulfanyl-2-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)phenoxy]phenyl]methanol (PubChem CID 135278633) has the molecular formula C23H23N2O3S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is [4-[4-ethylsulfanyl-2-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)phenoxy]phenyl]methanol.
| Compound Name | [4-[4-ethylsulfanyl-2-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)phenoxy]phenyl]methanol |
|---|---|
| PubChem CID | 135278633 |
| Molecular Formula | C23H23N2O3S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-[4-ethylsulfanyl-2-(7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)phenoxy]phenyl]methanol |
| SMILES | CCSc1ccc(Oc2ccc(CO)cc2)c(-c2cc(C)[n+](O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C23H22N2O3S/c1-3-29-18-8-9-22(28-17-6-4-16(14-26)5-7-17)21(13-18)20-12-15(2)25(27)23-19(20)10-11-24-23/h4-13,26-27H,3,14H2,1-2H3/p+1 |
| InChIKey | LBBUDEJXUWKPCU-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 69.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|