C22H25F2N2O2S+ — CID 135278896
4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfanylphenyl]-7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium (PubChem CID 135278896) has the molecular formula C22H25F2N2O2S+ and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfanylphenyl]-7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfanylphenyl]-7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 135278896 |
| Molecular Formula | C22H25F2N2O2S+ |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfanylphenyl]-7-hydroxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium |
| SMILES | CCSc1ccc(OC2CCC(F)(F)CC2)c(-c2cc(C)[n+](O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C22H24F2N2O2S/c1-3-29-16-4-5-20(28-15-6-9-22(23,24)10-7-15)19(13-16)18-12-14(2)26(27)21-17(18)8-11-25-21/h4-5,8,11-13,15,27H,3,6-7,9-10H2,1-2H3/p+1 |
| InChIKey | GPJPFXSRVTUSDF-UHFFFAOYSA-O |
| XLogP | 5.74 |
| TPSA | 49.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|