About 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one
5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one (PubChem CID 134311065) has the molecular formula C20H23F2NO2S
and a molecular weight of 379.47 g/mol. Its IUPAC name is 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one |
| PubChem CID | 134311065 |
| Molecular Formula | C20H23F2NO2S |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one |
| SMILES | CSc1ccc(OC2CCC(F)(F)CC2)c(-c2cc(C)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C20H23F2NO2S/c1-13-10-14(12-23(2)19(13)24)17-11-16(26-3)4-5-18(17)25-15-6-8-20(21,22)9-7-15/h4-5,10-12,15H,6-9H2,1-3H3 |
| InChIKey | ZQTQYCUOZDLRNS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one (CID 134311065) is 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one is CSc1ccc(OC2CCC(F)(F)CC2)c(-c2cc(C)c(=O)n(C)c2)c1.
What is the InChIKey of 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one?
The InChIKey is ZQTQYCUOZDLRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2NO2S/c1-13-10-14(12-23(2)19(13)24)17-11-16(26-3)4-5-18(17)25-15-6-8-20(21,22)9-7-15/h4-5,10-12,15H,6-9H2,1-3H3.
What are the key properties of 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one?
5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one has a molecular weight of 379.47 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4,4-difluorocyclohexyl)oxy-5-methylsulfanylphenyl]-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 134311065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).