C24H23F2NO5S — CID 118138006
4-ethylsulfonyl-10,12-difluoro-23-methyl-8,19-dioxa-23-azatetracyclo[18.4.0.02,7.09,14]tetracosa-1(24),2(7),3,5,9(14),10,12,20-octaen-22-one (PubChem CID 118138006) has the molecular formula C24H23F2NO5S and a molecular weight of 475.51 g/mol. Its IUPAC name is 4-ethylsulfonyl-10,12-difluoro-23-methyl-8,19-dioxa-23-azatetracyclo[18.4.0.02,7.09,14]tetracosa-1(24),2(7),3,5,9(14),10,12,20-octaen-22-one.
| Compound Name | 4-ethylsulfonyl-10,12-difluoro-23-methyl-8,19-dioxa-23-azatetracyclo[18.4.0.02,7.09,14]tetracosa-1(24),2(7),3,5,9(14),10,12,20-octaen-22-one |
|---|---|
| PubChem CID | 118138006 |
| Molecular Formula | C24H23F2NO5S |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-ethylsulfonyl-10,12-difluoro-23-methyl-8,19-dioxa-23-azatetracyclo[18.4.0.02,7.09,14]tetracosa-1(24),2(7),3,5,9(14),10,12,20-octaen-22-one |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)-c1cn(C)c(=O)cc1OCCCCc1cc(F)cc(F)c1O2 |
| InChI | InChI=1S/C24H23F2NO5S/c1-3-33(29,30)17-7-8-21-18(12-17)19-14-27(2)23(28)13-22(19)31-9-5-4-6-15-10-16(25)11-20(26)24(15)32-21/h7-8,10-14H,3-6,9H2,1-2H3 |
| InChIKey | APDGRTPKZUWEKY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |