C22H24F2N2O4S — CID 135278758
4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine (PubChem CID 135278758) has the molecular formula C22H24F2N2O4S and a molecular weight of 450.51 g/mol. Its IUPAC name is 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135278758 |
| Molecular Formula | C22H24F2N2O4S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-[2-(4,4-difluorocyclohexyl)oxy-5-ethylsulfonylphenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
| SMILES | CCS(=O)(=O)c1ccc(OC2CCC(F)(F)CC2)c(-c2cc(C)n(O)c3nccc2-3)c1 |
| InChI | InChI=1S/C22H24F2N2O4S/c1-3-31(28,29)16-4-5-20(30-15-6-9-22(23,24)10-7-15)19(13-16)18-12-14(2)26(27)21-17(18)8-11-25-21/h4-5,8,11-13,15,27H,3,6-7,9-10H2,1-2H3 |
| InChIKey | MPOALPIOCVMFOH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|