C26H34N2O4S — CID 135279066
7-hydroxy-6-methyl-4-[2-(4-propan-2-ylcyclohexyl)oxy-5-propan-2-ylsulfonylphenyl]pyrrolo[2,3-b]pyridine (PubChem CID 135279066) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is 7-hydroxy-6-methyl-4-[2-(4-propan-2-ylcyclohexyl)oxy-5-propan-2-ylsulfonylphenyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 7-hydroxy-6-methyl-4-[2-(4-propan-2-ylcyclohexyl)oxy-5-propan-2-ylsulfonylphenyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135279066 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 7-hydroxy-6-methyl-4-[2-(4-propan-2-ylcyclohexyl)oxy-5-propan-2-ylsulfonylphenyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc(-c2cc(S(=O)(=O)C(C)C)ccc2OC2CCC(C(C)C)CC2)c2ccnc-2n1O |
| InChI | InChI=1S/C26H34N2O4S/c1-16(2)19-6-8-20(9-7-19)32-25-11-10-21(33(30,31)17(3)4)15-24(25)23-14-18(5)28(29)26-22(23)12-13-27-26/h10-17,19-20,29H,6-9H2,1-5H3 |
| InChIKey | KFSPEJIDWDJATE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|